C17H23N5O2 — CID 167872383
1-[1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]pyrazole-4-carboxylic acid (PubChem CID 167872383) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167872383 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-[1-(2-tert-butylpyrimidin-4-yl)piperidin-4-yl]pyrazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1nccc(N2CCC(n3cc(C(=O)O)cn3)CC2)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-17(2,3)16-18-7-4-14(20-16)21-8-5-13(6-9-21)22-11-12(10-19-22)15(23)24/h4,7,10-11,13H,5-6,8-9H2,1-3H3,(H,23,24) |
| InChIKey | DVFZQKTUXFGBOX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |