C18H21F3N2O4S — CID 59619468
(1R,2R,4R)-N-(cyanomethyl)-2-propoxy-4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide (PubChem CID 59619468) has the molecular formula C18H21F3N2O4S and a molecular weight of 418.44 g/mol. Its IUPAC name is (1R,2R,4R)-N-(cyanomethyl)-2-propoxy-4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide.
| Compound Name | (1R,2R,4R)-N-(cyanomethyl)-2-propoxy-4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 59619468 |
| Molecular Formula | C18H21F3N2O4S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (1R,2R,4R)-N-(cyanomethyl)-2-propoxy-4-[2-(trifluoromethyl)phenyl]sulfonylcyclopentane-1-carboxamide |
| SMILES | CCCO[C@@H]1C[C@H](S(=O)(=O)c2ccccc2C(F)(F)F)C[C@H]1C(=O)NCC#N |
| InChI | InChI=1S/C18H21F3N2O4S/c1-2-9-27-15-11-12(10-13(15)17(24)23-8-7-22)28(25,26)16-6-4-3-5-14(16)18(19,20)21/h3-6,12-13,15H,2,8-11H2,1H3,(H,23,24)/t12-,13-,15-/m1/s1 |
| InChIKey | UENQQRJMWLNJGC-UMVBOHGHSA-N |
| XLogP | 2.69 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|