C18H22ClN3O4S — CID 75246480
4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(oxan-4-yl)pyrrolidine-2-carboxamide (PubChem CID 75246480) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(oxan-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | 4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 75246480 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonyl-N-(cyanomethyl)-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
| SMILES | N#CCNC(=O)C1CC(S(=O)(=O)c2ccccc2Cl)CN1C1CCOCC1 |
| InChI | InChI=1S/C18H22ClN3O4S/c19-15-3-1-2-4-17(15)27(24,25)14-11-16(18(23)21-8-7-20)22(12-14)13-5-9-26-10-6-13/h1-4,13-14,16H,5-6,8-12H2,(H,21,23) |
| InChIKey | SRJSSJAGBGASKJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|