C19H21ClN4O6S — CID 90105465
3-[[(1R,3S)-3-(2-chlorophenyl)sulfonylcyclopentyl]methoxy]-1H-pyridazin-6-one;cyanomethylcarbamic acid (PubChem CID 90105465) has the molecular formula C19H21ClN4O6S and a molecular weight of 468.92 g/mol. Its IUPAC name is 3-[[(1R,3S)-3-(2-chlorophenyl)sulfonylcyclopentyl]methoxy]-1H-pyridazin-6-one;cyanomethylcarbamic acid.
| Compound Name | 3-[[(1R,3S)-3-(2-chlorophenyl)sulfonylcyclopentyl]methoxy]-1H-pyridazin-6-one;cyanomethylcarbamic acid |
|---|---|
| PubChem CID | 90105465 |
| Molecular Formula | C19H21ClN4O6S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-[[(1R,3S)-3-(2-chlorophenyl)sulfonylcyclopentyl]methoxy]-1H-pyridazin-6-one;cyanomethylcarbamic acid |
| SMILES | N#CCNC(=O)O.O=c1ccc(OC[C@@H]2CC[C@H](S(=O)(=O)c3ccccc3Cl)C2)n[nH]1 |
| InChI | InChI=1S/C16H17ClN2O4S.C3H4N2O2/c17-13-3-1-2-4-14(13)24(21,22)12-6-5-11(9-12)10-23-16-8-7-15(20)18-19-16;4-1-2-5-3(6)7/h1-4,7-8,11-12H,5-6,9-10H2,(H,18,20);5H,2H2,(H,6,7)/t11-,12+;/m1./s1 |
| InChIKey | KAXCNKHBWREUNG-LYCTWNKOSA-N |
| XLogP | 2.22 |
| TPSA | 162.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|