C19H25N3O6S — CID 90106877
[(1R,3R)-3-(benzenesulfonyl)cyclopentyl]-morpholin-4-ylmethanone;cyanomethylcarbamic acid (PubChem CID 90106877) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is [(1R,3R)-3-(benzenesulfonyl)cyclopentyl]-morpholin-4-ylmethanone;cyanomethylcarbamic acid.
| Compound Name | [(1R,3R)-3-(benzenesulfonyl)cyclopentyl]-morpholin-4-ylmethanone;cyanomethylcarbamic acid |
|---|---|
| PubChem CID | 90106877 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [(1R,3R)-3-(benzenesulfonyl)cyclopentyl]-morpholin-4-ylmethanone;cyanomethylcarbamic acid |
| SMILES | N#CCNC(=O)O.O=C([C@@H]1CC[C@@H](S(=O)(=O)c2ccccc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C16H21NO4S.C3H4N2O2/c18-16(17-8-10-21-11-9-17)13-6-7-15(12-13)22(19,20)14-4-2-1-3-5-14;4-1-2-5-3(6)7/h1-5,13,15H,6-12H2;5H,2H2,(H,6,7)/t13-,15-;/m1./s1 |
| InChIKey | XJVMTHQUAAUXGU-SWYZXDRTSA-N |
| XLogP | 1.27 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|