C24H27NO6 — CID 10598463
2,3-dimethoxy-5-methyl-6-[(1S,3R)-3-(morpholine-4-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10598463) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(1S,3R)-3-(morpholine-4-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(1S,3R)-3-(morpholine-4-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10598463 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(1S,3R)-3-(morpholine-4-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C([C@H]2C[C@@H](C(=O)N3CCOCC3)Cc3ccccc32)=C(C)C1=O |
| InChI | InChI=1S/C24H27NO6/c1-14-19(21(27)23(30-3)22(29-2)20(14)26)18-13-16(12-15-6-4-5-7-17(15)18)24(28)25-8-10-31-11-9-25/h4-7,16,18H,8-13H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | NIAQZBQQRXAPKP-WMZOPIPTSA-N |
| XLogP | 2.16 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|