C15H28FNO5Si — CID 174165287
(2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-fluoropyrrolidine-1,2-dicarboxylic acid (PubChem CID 174165287) has the molecular formula C15H28FNO5Si and a molecular weight of 349.48 g/mol. Its IUPAC name is (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-fluoropyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-fluoropyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174165287 |
| Molecular Formula | C15H28FNO5Si |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (2S,4S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-fluoropyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@]1(C(=O)O)C[C@H](F)CN1C(=O)O |
| InChI | InChI=1S/C15H28FNO5Si/c1-14(2,3)23(4,5)22-8-6-7-15(12(18)19)9-11(16)10-17(15)13(20)21/h11H,6-10H2,1-5H3,(H,18,19)(H,20,21)/t11-,15-/m0/s1 |
| InChIKey | LYVZKGAVPGUUHZ-NHYWBVRUSA-N |
| XLogP | 3.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|