C8H10FNO5 — CID 91287750
(4S)-4-fluoro-2-(2-oxoethyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 91287750) has the molecular formula C8H10FNO5 and a molecular weight of 219.17 g/mol. Its IUPAC name is (4S)-4-fluoro-2-(2-oxoethyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (4S)-4-fluoro-2-(2-oxoethyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91287750 |
| Molecular Formula | C8H10FNO5 |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (4S)-4-fluoro-2-(2-oxoethyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=CCC1(C(=O)O)C[C@H](F)CN1C(=O)O |
| InChI | InChI=1S/C8H10FNO5/c9-5-3-8(1-2-11,6(12)13)10(4-5)7(14)15/h2,5H,1,3-4H2,(H,12,13)(H,14,15)/t5-,8?/m0/s1 |
| InChIKey | JEMDRKYNVCCPHQ-NTFOPCPOSA-N |
| XLogP | 0.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|