C8H11F2NO2 — CID 170356971
(2R,6S)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid (PubChem CID 170356971) has the molecular formula C8H11F2NO2 and a molecular weight of 191.18 g/mol. Its IUPAC name is (2R,6S)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid.
| Compound Name | (2R,6S)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 170356971 |
| Molecular Formula | C8H11F2NO2 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2R,6S)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
| SMILES | O=C(O)C12C[C@H](F)CN1C[C@H](F)C2 |
| InChI | InChI=1S/C8H11F2NO2/c9-5-1-8(7(12)13)2-6(10)4-11(8)3-5/h5-6H,1-4H2,(H,12,13)/t5-,6+,8? |
| InChIKey | IBDIUIIUJRFBCA-OFWQXNEASA-N |
| XLogP | 0.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |