C8H12FNO3 — CID 170357066
(2R,6R,8S)-2-fluoro-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid (PubChem CID 170357066) has the molecular formula C8H12FNO3 and a molecular weight of 189.19 g/mol. Its IUPAC name is (2R,6R,8S)-2-fluoro-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid.
| Compound Name | (2R,6R,8S)-2-fluoro-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
|---|---|
| PubChem CID | 170357066 |
| Molecular Formula | C8H12FNO3 |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2R,6R,8S)-2-fluoro-6-hydroxy-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylic acid |
| SMILES | O=C(O)[C@@]12C[C@@H](O)CN1C[C@H](F)C2 |
| InChI | InChI=1S/C8H12FNO3/c9-5-1-8(7(12)13)2-6(11)4-10(8)3-5/h5-6,11H,1-4H2,(H,12,13)/t5-,6-,8-/m1/s1 |
| InChIKey | JDIRKJJTDQRNMI-ATRFCDNQSA-N |
| XLogP | -0.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |