C14H21F2NO2S — CID 177213248
fluoromethane;methyl (2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate;thiophene (PubChem CID 177213248) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is fluoromethane;methyl (2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate;thiophene.
| Compound Name | fluoromethane;methyl (2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate;thiophene |
|---|---|
| PubChem CID | 177213248 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | fluoromethane;methyl (2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate;thiophene |
| SMILES | CF.COC(=O)[C@@]12CCCN1C[C@@H](F)C2.c1ccsc1 |
| InChI | InChI=1S/C9H14FNO2.C4H4S.CH3F/c1-13-8(12)9-3-2-4-11(9)6-7(10)5-9;1-2-4-5-3-1;1-2/h7H,2-6H2,1H3;1-4H;1H3/t7-,9-;;/m0../s1 |
| InChIKey | LRYQVCUVNWPWKE-VZIDAPDWSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |