About methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate
methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate (PubChem CID 169171710) has the molecular formula C10H15F2NO2
and a molecular weight of 219.23 g/mol. Its IUPAC name is methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate.
Analyze methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate (CID 169171710) is methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate is COC(=O)C1(N2CCC(F)(F)CC2)CC1.
What is the InChIKey of methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate?
The InChIKey is PZQQPEKRNDRNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2NO2/c1-15-8(14)9(2-3-9)13-6-4-10(11,12)5-7-13/h2-7H2,1H3.
What are the key properties of methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate?
methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate has a molecular weight of 219.23 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4,4-difluoropiperidin-1-yl)cyclopropane-1-carboxylate is sourced from PubChem (CID 169171710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).