C9H15NO5 — CID 90904982
(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 90904982) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90904982 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC[C@]1(C(=O)O)C[C@@H](OC)CN1C(=O)O |
| InChI | InChI=1S/C9H15NO5/c1-3-9(7(11)12)4-6(15-2)5-10(9)8(13)14/h6H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,9-/m1/s1 |
| InChIKey | NHBXKHSRPHSQPL-HZGVNTEJSA-N |
| XLogP | 0.62 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |