(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid

C9H15NO5 — CID 90904982

IUPAC(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid
SMILESCC[C@]1(C(=O)O)C[C@@H](OC)CN1C(=O)O
InChIInChI=1S/C9H15NO5/c1-3-9(7(11)12)4-6(15-2)5-10(9)8(13)14/h6H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,9-/m1/s1
InChIKeyNHBXKHSRPHSQPL-HZGVNTEJSA-N
MW217.22 g/mol
LogP0.62
Rot. Bonds3

About (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid

(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid (PubChem CID 90904982) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid
PubChem CID90904982
Molecular FormulaC9H15NO5
Molecular Weight217.22 g/mol
Exact Mass217.10
IUPAC Name(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid
SMILESCC[C@]1(C(=O)O)C[C@@H](OC)CN1C(=O)O
InChIInChI=1S/C9H15NO5/c1-3-9(7(11)12)4-6(15-2)5-10(9)8(13)14/h6H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,9-/m1/s1
InChIKeyNHBXKHSRPHSQPL-HZGVNTEJSA-N
XLogP0.62
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.22
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid (CID 90904982) is (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid is CC[C@]1(C(=O)O)C[C@@H](OC)CN1C(=O)O.
What is the InChIKey of (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid?
The InChIKey is NHBXKHSRPHSQPL-HZGVNTEJSA-N. The full InChI is InChI=1S/C9H15NO5/c1-3-9(7(11)12)4-6(15-2)5-10(9)8(13)14/h6H,3-5H2,1-2H3,(H,11,12)(H,13,14)/t6-,9-/m1/s1.
What are the key properties of (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid?
(2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid has a molecular weight of 217.22 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4R)-2-ethyl-4-methoxypyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 90904982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).