C14H29FN2O3Si — CID 68610096
[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl]carbamic acid (PubChem CID 68610096) has the molecular formula C14H29FN2O3Si and a molecular weight of 320.48 g/mol. Its IUPAC name is [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl]carbamic acid.
| Compound Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 68610096 |
| Molecular Formula | C14H29FN2O3Si |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | [1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-fluoropiperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CCC(NC(=O)O)C(F)C1 |
| InChI | InChI=1S/C14H29FN2O3Si/c1-14(2,3)21(4,5)20-9-8-17-7-6-12(11(15)10-17)16-13(18)19/h11-12,16H,6-10H2,1-5H3,(H,18,19) |
| InChIKey | UZRJBVFPKOZKLN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|