C17H35NO3Si — CID 171548487
(2R,3R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-azaspiro[4.5]decane-2,3-diol (PubChem CID 171548487) has the molecular formula C17H35NO3Si and a molecular weight of 329.56 g/mol. Its IUPAC name is (2R,3R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-azaspiro[4.5]decane-2,3-diol.
| Compound Name | (2R,3R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-azaspiro[4.5]decane-2,3-diol |
|---|---|
| PubChem CID | 171548487 |
| Molecular Formula | C17H35NO3Si |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (2R,3R)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-azaspiro[4.5]decane-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CCC2(CC1)C[C@@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C17H35NO3Si/c1-16(2,3)22(4,5)21-11-10-18-8-6-17(7-9-18)12-14(19)15(20)13-17/h14-15,19-20H,6-13H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | SYZZKIWMPZQVKR-HUUCEWRRSA-N |
| XLogP | 2.61 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|