C18H32N4O2Si — CID 140876648
(6-amino-3-pyridinyl)-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methanone (PubChem CID 140876648) has the molecular formula C18H32N4O2Si and a molecular weight of 364.57 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methanone.
| Compound Name | (6-amino-3-pyridinyl)-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 140876648 |
| Molecular Formula | C18H32N4O2Si |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (6-amino-3-pyridinyl)-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]methanone |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CCN(C(=O)c2ccc(N)nc2)CC1 |
| InChI | InChI=1S/C18H32N4O2Si/c1-18(2,3)25(4,5)24-13-12-21-8-10-22(11-9-21)17(23)15-6-7-16(19)20-14-15/h6-7,14H,8-13H2,1-5H3,(H2,19,20) |
| InChIKey | GSWOEMHWNBZPEF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|