C24H33N3O3 — CID 91625393
[6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-pyridinyl]-[4-(2-phenylethyl)piperazin-1-yl]methanone (PubChem CID 91625393) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is [6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-pyridinyl]-[4-(2-phenylethyl)piperazin-1-yl]methanone.
| Compound Name | [6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-pyridinyl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91625393 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | [6-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-3-pyridinyl]-[4-(2-phenylethyl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)OCCOc1ccc(C(=O)N2CCN(CCc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C24H33N3O3/c1-24(2,3)30-18-17-29-22-10-9-21(19-25-22)23(28)27-15-13-26(14-16-27)12-11-20-7-5-4-6-8-20/h4-10,19H,11-18H2,1-3H3 |
| InChIKey | YUWZJSMYKKDGJY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|