C36H44N4O9 — CID 142785666
[1-[[2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methoxyphenyl]methyl-hept-6-enylcarbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate (PubChem CID 142785666) has the molecular formula C36H44N4O9 and a molecular weight of 676.77 g/mol. Its IUPAC name is [1-[[2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methoxyphenyl]methyl-hept-6-enylcarbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate.
| Compound Name | [1-[[2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methoxyphenyl]methyl-hept-6-enylcarbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 142785666 |
| Molecular Formula | C36H44N4O9 |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.31 |
| IUPAC Name | [1-[[2-[(2-ethenyl-1-ethoxycarbonylcyclopropyl)carbamoyl]-4-methoxyphenyl]methyl-hept-6-enylcarbamoyl]pyrrolidin-3-yl] 4-nitrobenzoate |
| SMILES | C=CCCCCCN(Cc1ccc(OC)cc1C(=O)NC1(C(=O)OCC)CC1C=C)C(=O)N1CCC(OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C36H44N4O9/c1-5-8-9-10-11-19-38(35(44)39-20-18-30(24-39)49-33(42)25-12-15-28(16-13-25)40(45)46)23-26-14-17-29(47-4)21-31(26)32(41)37-36(22-27(36)6-2)34(43)48-7-3/h5-6,12-17,21,27,30H,1-2,7-11,18-20,22-24H2,3-4H3,(H,37,41) |
| InChIKey | OVVBNRWAJYBGJJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|