C21H25N3O6 — CID 143731958
trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4S)-4-[2-(4-nitrophenyl)-2-oxoethyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate (PubChem CID 143731958) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4S)-4-[2-(4-nitrophenyl)-2-oxoethyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4S)-4-[2-(4-nitrophenyl)-2-oxoethyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 143731958 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | trans-ethyl (1R,2S)-2-ethenyl-1-[[(2S,4S)-4-[2-(4-nitrophenyl)-2-oxoethyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](CC(=O)c2ccc([N+](=O)[O-])cc2)CN1)C(=O)OCC |
| InChI | InChI=1S/C21H25N3O6/c1-3-15-11-21(15,20(27)30-4-2)23-19(26)17-9-13(12-22-17)10-18(25)14-5-7-16(8-6-14)24(28)29/h3,5-8,13,15,17,22H,1,4,9-12H2,2H3,(H,23,26)/t13-,15+,17-,21+/m0/s1 |
| InChIKey | XRZKXINCCYLZHB-DFIRMOIBSA-N |
| XLogP | 1.77 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|