C18H22BrClN2O6S — CID 56590059
trans-methyl (1R,2S)-1-[[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate;hydrochloride (PubChem CID 56590059) has the molecular formula C18H22BrClN2O6S and a molecular weight of 509.81 g/mol. Its IUPAC name is trans-methyl (1R,2S)-1-[[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate;hydrochloride.
| Compound Name | trans-methyl (1R,2S)-1-[[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 56590059 |
| Molecular Formula | C18H22BrClN2O6S |
| Molecular Weight | 509.81 g/mol |
| Exact Mass | 508.01 |
| IUPAC Name | trans-methyl (1R,2S)-1-[[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate;hydrochloride |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(Br)cc2)CN1)C(=O)OC.Cl |
| InChI | InChI=1S/C18H21BrN2O6S.ClH/c1-3-11-9-18(11,17(23)26-2)21-16(22)15-8-13(10-20-15)27-28(24,25)14-6-4-12(19)5-7-14;/h3-7,11,13,15,20H,1,8-10H2,2H3,(H,21,22);1H/t11-,13+,15+,18-;/m1./s1 |
| InChIKey | HICUITMJGMSQNR-OGQJTERRSA-N |
| XLogP | 1.54 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.81 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|