C24H28N2O6S — CID 163559690
tert-butyl N-[(1R)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]carbamate (PubChem CID 163559690) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is tert-butyl N-[(1R)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 163559690 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | tert-butyl N-[(1R)-2-ethenyl-1-[(3-phenylmethoxyphenyl)sulfonylcarbamoyl]cyclopropyl]carbamate |
| SMILES | C=CC1C[C@]1(NC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-5-18-15-24(18,25-22(28)32-23(2,3)4)21(27)26-33(29,30)20-13-9-12-19(14-20)31-16-17-10-7-6-8-11-17/h5-14,18H,1,15-16H2,2-4H3,(H,25,28)(H,26,27)/t18?,24-/m1/s1 |
| InChIKey | FQDZDLUAGWYTMI-VCUSLETLSA-N |
| XLogP | 3.54 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|