C22H25NO4S — CID 59009647
cis-(1R,2S)-2-ethenyl-N-(3-phenylmethoxyphenyl)sulfonyl-1-propan-2-ylcyclopropane-1-carboxamide (PubChem CID 59009647) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is cis-(1R,2S)-2-ethenyl-N-(3-phenylmethoxyphenyl)sulfonyl-1-propan-2-ylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-ethenyl-N-(3-phenylmethoxyphenyl)sulfonyl-1-propan-2-ylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 59009647 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | cis-(1R,2S)-2-ethenyl-N-(3-phenylmethoxyphenyl)sulfonyl-1-propan-2-ylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)c1cccc(OCc2ccccc2)c1)C(C)C |
| InChI | InChI=1S/C22H25NO4S/c1-4-18-14-22(18,16(2)3)21(24)23-28(25,26)20-12-8-11-19(13-20)27-15-17-9-6-5-7-10-17/h4-13,16,18H,1,14-15H2,2-3H3,(H,23,24)/t18-,22-/m1/s1 |
| InChIKey | UOERMVSOCRRCLI-XMSQKQJNSA-N |
| XLogP | 3.92 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|