C13H16N2O3S — CID 89298424
trans-(1S,2S)-2-ethenyl-1-ethyl-N-pyridin-3-ylsulfonylcyclopropane-1-carboxamide (PubChem CID 89298424) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-ethenyl-1-ethyl-N-pyridin-3-ylsulfonylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-ethenyl-1-ethyl-N-pyridin-3-ylsulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89298424 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | trans-(1S,2S)-2-ethenyl-1-ethyl-N-pyridin-3-ylsulfonylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(CC)C(=O)NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C13H16N2O3S/c1-3-10-8-13(10,4-2)12(16)15-19(17,18)11-6-5-7-14-9-11/h3,5-7,9-10H,1,4,8H2,2H3,(H,15,16)/t10-,13+/m1/s1 |
| InChIKey | CMXWBWWTGQZOJZ-MFKMUULPSA-N |
| XLogP | 1.49 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|