C23H25NO6S — CID 59665702
ethyl 3-[[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]phenyl]methoxy]benzoate (PubChem CID 59665702) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is ethyl 3-[[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]phenyl]methoxy]benzoate.
| Compound Name | ethyl 3-[[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 59665702 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethyl 3-[[3-[[(1S,2S)-2-ethenyl-1-methylcyclopropanecarbonyl]sulfamoyl]phenyl]methoxy]benzoate |
| SMILES | C=C[C@@H]1C[C@]1(C)C(=O)NS(=O)(=O)c1cccc(COc2cccc(C(=O)OCC)c2)c1 |
| InChI | InChI=1S/C23H25NO6S/c1-4-18-14-23(18,3)22(26)24-31(27,28)20-11-6-8-16(12-20)15-30-19-10-7-9-17(13-19)21(25)29-5-2/h4,6-13,18H,1,5,14-15H2,2-3H3,(H,24,26)/t18-,23+/m1/s1 |
| InChIKey | HTANBLDIKVCNJK-JPYJTQIMSA-N |
| XLogP | 3.46 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|