C17H20ClNO5S — CID 89298425
ethyl 4-chloro-3-[[(1S,2S)-2-ethenyl-1-ethylcyclopropanecarbonyl]sulfamoyl]benzoate (PubChem CID 89298425) has the molecular formula C17H20ClNO5S and a molecular weight of 385.87 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[(1S,2S)-2-ethenyl-1-ethylcyclopropanecarbonyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-chloro-3-[[(1S,2S)-2-ethenyl-1-ethylcyclopropanecarbonyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 89298425 |
| Molecular Formula | C17H20ClNO5S |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | ethyl 4-chloro-3-[[(1S,2S)-2-ethenyl-1-ethylcyclopropanecarbonyl]sulfamoyl]benzoate |
| SMILES | C=C[C@@H]1C[C@]1(CC)C(=O)NS(=O)(=O)c1cc(C(=O)OCC)ccc1Cl |
| InChI | InChI=1S/C17H20ClNO5S/c1-4-12-10-17(12,5-2)16(21)19-25(22,23)14-9-11(7-8-13(14)18)15(20)24-6-3/h4,7-9,12H,1,5-6,10H2,2-3H3,(H,19,21)/t12-,17+/m1/s1 |
| InChIKey | LLVRMBZEOBEFRG-PXAZEXFGSA-N |
| XLogP | 2.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|