C15H20N2O3S — CID 89298427
trans-(1S,2S)-2-ethenyl-1-ethyl-N-[2-(methylamino)phenyl]sulfonylcyclopropane-1-carboxamide (PubChem CID 89298427) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is trans-(1S,2S)-2-ethenyl-1-ethyl-N-[2-(methylamino)phenyl]sulfonylcyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-ethenyl-1-ethyl-N-[2-(methylamino)phenyl]sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 89298427 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | trans-(1S,2S)-2-ethenyl-1-ethyl-N-[2-(methylamino)phenyl]sulfonylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(CC)C(=O)NS(=O)(=O)c1ccccc1NC |
| InChI | InChI=1S/C15H20N2O3S/c1-4-11-10-15(11,5-2)14(18)17-21(19,20)13-9-7-6-8-12(13)16-3/h4,6-9,11,16H,1,5,10H2,2-3H3,(H,17,18)/t11-,15+/m1/s1 |
| InChIKey | RCTAGRMKAAGJIE-ABAIWWIYSA-N |
| XLogP | 2.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|