C18H27N3O3S — CID 143643311
trans-(1R,2S)-1-amino-2-ethenyl-N-[2-(hexylamino)phenyl]sulfonylcyclopropane-1-carboxamide (PubChem CID 143643311) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is trans-(1R,2S)-1-amino-2-ethenyl-N-[2-(hexylamino)phenyl]sulfonylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2S)-1-amino-2-ethenyl-N-[2-(hexylamino)phenyl]sulfonylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143643311 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | trans-(1R,2S)-1-amino-2-ethenyl-N-[2-(hexylamino)phenyl]sulfonylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1C[C@]1(N)C(=O)NS(=O)(=O)c1ccccc1NCCCCCC |
| InChI | InChI=1S/C18H27N3O3S/c1-3-5-6-9-12-20-15-10-7-8-11-16(15)25(23,24)21-17(22)18(19)13-14(18)4-2/h4,7-8,10-11,14,20H,2-3,5-6,9,12-13,19H2,1H3,(H,21,22)/t14-,18-/m1/s1 |
| InChIKey | QXHMCFXUTRBFMK-RDTXWAMCSA-N |
| XLogP | 2.39 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|