C32H47N5O9S — CID 59493379
(2S)-2-(cyclopentyloxycarbonylamino)-9-[2-[[(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]cyclopropanecarbonyl]sulfamoyl]anilino]nonanoic acid (PubChem CID 59493379) has the molecular formula C32H47N5O9S and a molecular weight of 677.82 g/mol. Its IUPAC name is (2S)-2-(cyclopentyloxycarbonylamino)-9-[2-[[(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]cyclopropanecarbonyl]sulfamoyl]anilino]nonanoic acid.
| Compound Name | (2S)-2-(cyclopentyloxycarbonylamino)-9-[2-[[(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]cyclopropanecarbonyl]sulfamoyl]anilino]nonanoic acid |
|---|---|
| PubChem CID | 59493379 |
| Molecular Formula | C32H47N5O9S |
| Molecular Weight | 677.82 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | (2S)-2-(cyclopentyloxycarbonylamino)-9-[2-[[(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]amino]cyclopropanecarbonyl]sulfamoyl]anilino]nonanoic acid |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](O)CN1)C(=O)NS(=O)(=O)c1ccccc1NCCCCCCC[C@H](NC(=O)OC1CCCC1)C(=O)O |
| InChI | InChI=1S/C32H47N5O9S/c1-2-21-19-32(21,36-28(39)26-18-22(38)20-34-26)30(42)37-47(44,45)27-16-10-9-14-24(27)33-17-11-5-3-4-6-15-25(29(40)41)35-31(43)46-23-12-7-8-13-23/h2,9-10,14,16,21-23,25-26,33-34,38H,1,3-8,11-13,15,17-20H2,(H,35,43)(H,36,39)(H,37,42)(H,40,41)/t21-,22-,25+,26+,32-/m1/s1 |
| InChIKey | QVFJCTVYEQLMIY-WAKXTCDHSA-N |
| XLogP | 2.15 |
| TPSA | 212.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|