C14H21N3O5S — CID 23595529
N-[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 23595529) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23595529 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | C=CC1CC1(NC(=O)C1CC(O)CN1)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H21N3O5S/c1-2-8-6-14(8,13(20)17-23(21,22)10-3-4-10)16-12(19)11-5-9(18)7-15-11/h2,8-11,15,18H,1,3-7H2,(H,16,19)(H,17,20) |
| InChIKey | UAMGRRNBHPMWLF-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|