C26H30N4O6S2 — CID 25141601
N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-[(E)-(5-methoxy-2-thiophen-2-ylphenyl)methylideneamino]oxypyrrolidine-2-carboxamide (PubChem CID 25141601) has the molecular formula C26H30N4O6S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-[(E)-(5-methoxy-2-thiophen-2-ylphenyl)methylideneamino]oxypyrrolidine-2-carboxamide.
| Compound Name | N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-[(E)-(5-methoxy-2-thiophen-2-ylphenyl)methylideneamino]oxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25141601 |
| Molecular Formula | C26H30N4O6S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-[(E)-(5-methoxy-2-thiophen-2-ylphenyl)methylideneamino]oxypyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(NC(=O)C1CC(O/N=C/c2cc(OC)ccc2-c2cccs2)CN1)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C26H30N4O6S2/c1-3-17-13-26(17,25(32)30-38(33,34)20-7-8-20)29-24(31)22-12-19(15-27-22)36-28-14-16-11-18(35-2)6-9-21(16)23-5-4-10-37-23/h3-6,9-11,14,17,19-20,22,27H,1,7-8,12-13,15H2,2H3,(H,29,31)(H,30,32)/b28-14+/t17-,19?,22?,26+/m1/s1 |
| InChIKey | QDVFYMPBVOJTAC-IBNJRWPOSA-N |
| XLogP | 2.17 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|