C10H15ClN2O5S — CID 67068429
[1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamic acid;hydrochloride (PubChem CID 67068429) has the molecular formula C10H15ClN2O5S and a molecular weight of 310.76 g/mol. Its IUPAC name is [1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamic acid;hydrochloride.
| Compound Name | [1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamic acid;hydrochloride |
|---|---|
| PubChem CID | 67068429 |
| Molecular Formula | C10H15ClN2O5S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamic acid;hydrochloride |
| SMILES | C=CC1CC1(NC(=O)O)C(=O)NS(=O)(=O)C1CC1.Cl |
| InChI | InChI=1S/C10H14N2O5S.ClH/c1-2-6-5-10(6,11-9(14)15)8(13)12-18(16,17)7-3-4-7;/h2,6-7,11H,1,3-5H2,(H,12,13)(H,14,15);1H |
| InChIKey | ASPPBJVZCWFJPD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|