C11H15FN2O5S — CID 89156498
[(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]carbamic acid (PubChem CID 89156498) has the molecular formula C11H15FN2O5S and a molecular weight of 306.32 g/mol. Its IUPAC name is [(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]carbamic acid.
| Compound Name | [(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]carbamic acid |
|---|---|
| PubChem CID | 89156498 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | [(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]carbamic acid |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)O)C(=O)NS(=O)(=O)C1(CF)CC1 |
| InChI | InChI=1S/C11H15FN2O5S/c1-2-7-5-11(7,13-9(16)17)8(15)14-20(18,19)10(6-12)3-4-10/h2,7,13H,1,3-6H2,(H,14,15)(H,16,17)/t7-,11-/m1/s1 |
| InChIKey | ZOGWSVJIAWBRFS-RDDDGLTNSA-N |
| XLogP | 0.15 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|