C14H25N3O5S — CID 59386553
tert-butyl N-[(1R,2S)-2-ethenyl-1-[[ethyl(methyl)sulfamoyl]carbamoyl]cyclopropyl]carbamate (PubChem CID 59386553) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-ethenyl-1-[[ethyl(methyl)sulfamoyl]carbamoyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-ethenyl-1-[[ethyl(methyl)sulfamoyl]carbamoyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 59386553 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-ethenyl-1-[[ethyl(methyl)sulfamoyl]carbamoyl]cyclopropyl]carbamate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)N(C)CC |
| InChI | InChI=1S/C14H25N3O5S/c1-7-10-9-14(10,15-12(19)22-13(3,4)5)11(18)16-23(20,21)17(6)8-2/h7,10H,1,8-9H2,2-6H3,(H,15,19)(H,16,18)/t10-,14-/m1/s1 |
| InChIKey | QNPVFVMOZXEZKS-QMTHXVAHSA-N |
| XLogP | 0.77 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|