C16H24FNO5S — CID 146732242
tert-butyl 2-[(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]acetate (PubChem CID 146732242) has the molecular formula C16H24FNO5S and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 146732242 |
| Molecular Formula | C16H24FNO5S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | tert-butyl 2-[(1R,2S)-2-ethenyl-1-[[1-(fluoromethyl)cyclopropyl]sulfonylcarbamoyl]cyclopropyl]acetate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)C1(CF)CC1 |
| InChI | InChI=1S/C16H24FNO5S/c1-5-11-8-16(11,9-12(19)23-14(2,3)4)13(20)18-24(21,22)15(10-17)6-7-15/h5,11H,1,6-10H2,2-4H3,(H,18,20)/t11-,16-/m1/s1 |
| InChIKey | RIFDHUSIRWEEPA-BDJLRTHQSA-N |
| XLogP | 1.86 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|