C16H24O5S — CID 58558877
tert-butyl 2-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]acetate (PubChem CID 58558877) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is tert-butyl 2-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]acetate.
| Compound Name | tert-butyl 2-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]acetate |
|---|---|
| PubChem CID | 58558877 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | tert-butyl 2-[(1R,2S)-1-(2-cyclopropylsulfonylacetyl)-2-ethenylcyclopropyl]acetate |
| SMILES | C=C[C@@H]1C[C@]1(CC(=O)OC(C)(C)C)C(=O)CS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C16H24O5S/c1-5-11-8-16(11,9-14(18)21-15(2,3)4)13(17)10-22(19,20)12-6-7-12/h5,11-12H,1,6-10H2,2-4H3/t11-,16-/m1/s1 |
| InChIKey | ZJBHJFAWIZOMLJ-BDJLRTHQSA-N |
| XLogP | 2.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|