About [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid
[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid (PubChem CID 66896767) has the molecular formula C10H16N2O5S
and a molecular weight of 276.31 g/mol. Its IUPAC name is [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid |
| PubChem CID | 66896767 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid |
| SMILES | CC[C@@H]1C[C@]1(NC(=O)O)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C10H16N2O5S/c1-2-6-5-10(6,11-9(14)15)8(13)12-18(16,17)7-3-4-7/h6-7,11H,2-5H2,1H3,(H,12,13)(H,14,15)/t6-,10-/m1/s1 |
| InChIKey | VTPDNRKDHMHECU-LHLIQPBNSA-N |
| XLogP | 0.03 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid?
The IUPAC name of [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid (CID 66896767) is [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid.
What is the SMILES notation for [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid?
The canonical SMILES for [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid is CC[C@@H]1C[C@]1(NC(=O)O)C(=O)NS(=O)(=O)C1CC1.
What is the InChIKey of [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid?
The InChIKey is VTPDNRKDHMHECU-LHLIQPBNSA-N. The full InChI is InChI=1S/C10H16N2O5S/c1-2-6-5-10(6,11-9(14)15)8(13)12-18(16,17)7-3-4-7/h6-7,11H,2-5H2,1H3,(H,12,13)(H,14,15)/t6-,10-/m1/s1.
What are the key properties of [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid?
[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid has a molecular weight of 276.31 g/mol, XLogP of 0.03, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]carbamic acid is sourced from PubChem (CID 66896767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).