C23H37N3O6S — CID 89069414
(1R,2R,4S)-1-N-[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]-2-N-hex-5-enyl-4-hydroxy-2-N-methylcyclopentane-1,2-dicarboxamide (PubChem CID 89069414) has the molecular formula C23H37N3O6S and a molecular weight of 483.63 g/mol. Its IUPAC name is (1R,2R,4S)-1-N-[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]-2-N-hex-5-enyl-4-hydroxy-2-N-methylcyclopentane-1,2-dicarboxamide.
| Compound Name | (1R,2R,4S)-1-N-[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]-2-N-hex-5-enyl-4-hydroxy-2-N-methylcyclopentane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 89069414 |
| Molecular Formula | C23H37N3O6S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (1R,2R,4S)-1-N-[(1R,2R)-1-(cyclopropylsulfonylcarbamoyl)-2-ethylcyclopropyl]-2-N-hex-5-enyl-4-hydroxy-2-N-methylcyclopentane-1,2-dicarboxamide |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1C[C@@H](O)C[C@H]1C(=O)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1CC |
| InChI | InChI=1S/C23H37N3O6S/c1-4-6-7-8-11-26(3)21(29)19-13-16(27)12-18(19)20(28)24-23(14-15(23)5-2)22(30)25-33(31,32)17-9-10-17/h4,15-19,27H,1,5-14H2,2-3H3,(H,24,28)(H,25,30)/t15-,16+,18-,19-,23-/m1/s1 |
| InChIKey | QZDJQOCDXOBKJL-CGTNEQSUSA-N |
| XLogP | 1.08 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|