C24H36N2O6S — CID 159910147
(1R,2R,4S)-2-[2-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]acetyl]-N-hex-5-enyl-4-hydroxy-N-methylcyclopentane-1-carboxamide (PubChem CID 159910147) has the molecular formula C24H36N2O6S and a molecular weight of 480.63 g/mol. Its IUPAC name is (1R,2R,4S)-2-[2-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]acetyl]-N-hex-5-enyl-4-hydroxy-N-methylcyclopentane-1-carboxamide.
| Compound Name | (1R,2R,4S)-2-[2-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]acetyl]-N-hex-5-enyl-4-hydroxy-N-methylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 159910147 |
| Molecular Formula | C24H36N2O6S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (1R,2R,4S)-2-[2-[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]acetyl]-N-hex-5-enyl-4-hydroxy-N-methylcyclopentane-1-carboxamide |
| SMILES | C=CCCCCN(C)C(=O)[C@@H]1C[C@@H](O)C[C@H]1C(=O)C[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C |
| InChI | InChI=1S/C24H36N2O6S/c1-4-6-7-8-11-26(3)22(29)20-13-17(27)12-19(20)21(28)15-24(14-16(24)5-2)23(30)25-33(31,32)18-9-10-18/h4-5,16-20,27H,1-2,6-15H2,3H3,(H,25,30)/t16-,17+,19-,20-,24-/m1/s1 |
| InChIKey | RBJMCXVLZPJTRD-YPTMSUPPSA-N |
| XLogP | 1.95 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|