C24H36O5 — CID 58535031
trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(1R,2R,4R)-4-hydroxy-2-non-8-enoylcyclopentyl]-2-oxoethyl]cyclopropane-1-carboxylate (PubChem CID 58535031) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(1R,2R,4R)-4-hydroxy-2-non-8-enoylcyclopentyl]-2-oxoethyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(1R,2R,4R)-4-hydroxy-2-non-8-enoylcyclopentyl]-2-oxoethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58535031 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(1R,2R,4R)-4-hydroxy-2-non-8-enoylcyclopentyl]-2-oxoethyl]cyclopropane-1-carboxylate |
| SMILES | C=CCCCCCCC(=O)[C@@H]1C[C@@H](O)C[C@H]1C(=O)C[C@]1(C(=O)OCC)C[C@H]1C=C |
| InChI | InChI=1S/C24H36O5/c1-4-7-8-9-10-11-12-21(26)19-13-18(25)14-20(19)22(27)16-24(15-17(24)5-2)23(28)29-6-3/h4-5,17-20,25H,1-2,6-16H2,3H3/t17-,18-,19-,20-,24-/m1/s1 |
| InChIKey | PYGXPZRABDQIIB-UFUUVDDWSA-N |
| XLogP | 4.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|