C23H30N2O7 — CID 149032249
[(3S,5S)-5-[4-[(1S,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]butanoyl]pyrrolidin-3-yl] 4-nitrocyclohexa-2,4-diene-1-carboxylate (PubChem CID 149032249) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(3S,5S)-5-[4-[(1S,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]butanoyl]pyrrolidin-3-yl] 4-nitrocyclohexa-2,4-diene-1-carboxylate.
| Compound Name | [(3S,5S)-5-[4-[(1S,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]butanoyl]pyrrolidin-3-yl] 4-nitrocyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 149032249 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | [(3S,5S)-5-[4-[(1S,2S)-2-ethenyl-1-ethoxycarbonylcyclopropyl]butanoyl]pyrrolidin-3-yl] 4-nitrocyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(CCCC(=O)[C@@H]1C[C@H](OC(=O)C2C=CC([N+](=O)[O-])=CC2)CN1)C(=O)OCC |
| InChI | InChI=1S/C23H30N2O7/c1-3-16-13-23(16,22(28)31-4-2)11-5-6-20(26)19-12-18(14-24-19)32-21(27)15-7-9-17(10-8-15)25(29)30/h3,7,9-10,15-16,18-19,24H,1,4-6,8,11-14H2,2H3/t15?,16-,18+,19+,23+/m1/s1 |
| InChIKey | QFVSGVAWFUMPOO-HRQOWWIFSA-N |
| XLogP | 2.49 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|