C28H44N4O6 — CID 140551147
cis-ethyl (1R,2R)-1-[[(2S)-4-[(2-cyclohexyl-6-nitro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)oxy]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate (PubChem CID 140551147) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-[[(2S)-4-[(2-cyclohexyl-6-nitro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)oxy]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-[[(2S)-4-[(2-cyclohexyl-6-nitro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)oxy]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 140551147 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | cis-ethyl (1R,2R)-1-[[(2S)-4-[(2-cyclohexyl-6-nitro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-4-yl)oxy]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)[C@@H]1CC(OC2CC(C3CCCCC3)NC3CCC([N+](=O)[O-])CC32)CN1)C(=O)OCC |
| InChI | InChI=1S/C28H44N4O6/c1-3-18-15-28(18,27(34)37-4-2)31-26(33)24-13-20(16-29-24)38-25-14-23(17-8-6-5-7-9-17)30-22-11-10-19(32(35)36)12-21(22)25/h3,17-25,29-30H,1,4-16H2,2H3,(H,31,33)/t18-,19?,20?,21?,22?,23?,24-,25?,28+/m0/s1 |
| InChIKey | KEAFGBDCMOKBJM-UOBGMJCRSA-N |
| XLogP | 2.48 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|