C23H35NO5 — CID 157173678
methyl (2S)-2-ethenyl-1-[2-[(2S,4R)-4-hydroxy-1-[(2S)-2-methylnon-8-enoyl]pyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate (PubChem CID 157173678) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is methyl (2S)-2-ethenyl-1-[2-[(2S,4R)-4-hydroxy-1-[(2S)-2-methylnon-8-enoyl]pyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate.
| Compound Name | methyl (2S)-2-ethenyl-1-[2-[(2S,4R)-4-hydroxy-1-[(2S)-2-methylnon-8-enoyl]pyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 157173678 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | methyl (2S)-2-ethenyl-1-[2-[(2S,4R)-4-hydroxy-1-[(2S)-2-methylnon-8-enoyl]pyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate |
| SMILES | C=CCCCCC[C@H](C)C(=O)N1C[C@H](O)C[C@H]1C(=O)CC1(C(=O)OC)C[C@H]1C=C |
| InChI | InChI=1S/C23H35NO5/c1-5-7-8-9-10-11-16(3)21(27)24-15-18(25)12-19(24)20(26)14-23(22(28)29-4)13-17(23)6-2/h5-6,16-19,25H,1-2,7-15H2,3-4H3/t16-,17+,18+,19-,23?/m0/s1 |
| InChIKey | UTAYFDCTZTXYHU-ROIOCTRCSA-N |
| XLogP | 3.05 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|