C21H35NO6 — CID 58212623
methyl (2S,4S)-4-hydroxy-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate (PubChem CID 58212623) has the molecular formula C21H35NO6 and a molecular weight of 397.51 g/mol. Its IUPAC name is methyl (2S,4S)-4-hydroxy-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-hydroxy-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 58212623 |
| Molecular Formula | C21H35NO6 |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | methyl (2S,4S)-4-hydroxy-1-[(2R)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCCCCC[C@H](CC(=O)OC(C)(C)C)C(=O)N1C[C@@H](O)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H35NO6/c1-6-7-8-9-10-11-15(12-18(24)28-21(2,3)4)19(25)22-14-16(23)13-17(22)20(26)27-5/h6,15-17,23H,1,7-14H2,2-5H3/t15-,16+,17+/m1/s1 |
| InChIKey | GLZRUHAEJQKOHV-IKGGRYGDSA-N |
| XLogP | 2.61 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|