C18H29NO4 — CID 58091444
(2S)-2-cyclopentyl-4-oxo-4-[(3R)-3-pent-4-enoxypyrrolidin-1-yl]butanoic acid (PubChem CID 58091444) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-4-oxo-4-[(3R)-3-pent-4-enoxypyrrolidin-1-yl]butanoic acid.
| Compound Name | (2S)-2-cyclopentyl-4-oxo-4-[(3R)-3-pent-4-enoxypyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 58091444 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (2S)-2-cyclopentyl-4-oxo-4-[(3R)-3-pent-4-enoxypyrrolidin-1-yl]butanoic acid |
| SMILES | C=CCCCO[C@@H]1CCN(C(=O)CC(C(=O)O)C2CCCC2)C1 |
| InChI | InChI=1S/C18H29NO4/c1-2-3-6-11-23-15-9-10-19(13-15)17(20)12-16(18(21)22)14-7-4-5-8-14/h2,14-16H,1,3-13H2,(H,21,22)/t15-,16?/m1/s1 |
| InChIKey | GIGQYWHMCPJFNL-AAFJCEBUSA-N |
| XLogP | 2.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|