C29H49NO6 — CID 162951906
methyl (2R)-1-[[(3S,4S,5R)-5-[(E)-heptadec-6-enyl]-4-hydroxy-5-methyl-2-oxooxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate (PubChem CID 162951906) has the molecular formula C29H49NO6 and a molecular weight of 507.71 g/mol. Its IUPAC name is methyl (2R)-1-[[(3S,4S,5R)-5-[(E)-heptadec-6-enyl]-4-hydroxy-5-methyl-2-oxooxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[[(3S,4S,5R)-5-[(E)-heptadec-6-enyl]-4-hydroxy-5-methyl-2-oxooxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 162951906 |
| Molecular Formula | C29H49NO6 |
| Molecular Weight | 507.71 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | methyl (2R)-1-[[(3S,4S,5R)-5-[(E)-heptadec-6-enyl]-4-hydroxy-5-methyl-2-oxooxolan-3-yl]methyl]-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCCCCC/C=C/CCCCC[C@@]1(C)OC(=O)[C@@H](CN2C(=O)CC[C@@H]2C(=O)OC)[C@@H]1O |
| InChI | InChI=1S/C29H49NO6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29(2)26(32)23(27(33)36-29)22-30-24(28(34)35-3)19-20-25(30)31/h13-14,23-24,26,32H,4-12,15-22H2,1-3H3/b14-13+/t23-,24+,26-,29+/m0/s1 |
| InChIKey | HOIXMWRSFMLYHV-FXGPQLTBSA-N |
| XLogP | 5.48 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.71 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|