C24H41NO8 — CID 142059057
ditert-butyl (2R,4S,5R)-5-(2,3-diethoxy-1-hydroxy-3-oxopropyl)-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 142059057) has the molecular formula C24H41NO8 and a molecular weight of 471.59 g/mol. Its IUPAC name is ditert-butyl (2R,4S,5R)-5-(2,3-diethoxy-1-hydroxy-3-oxopropyl)-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4S,5R)-5-(2,3-diethoxy-1-hydroxy-3-oxopropyl)-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142059057 |
| Molecular Formula | C24H41NO8 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | ditert-butyl (2R,4S,5R)-5-(2,3-diethoxy-1-hydroxy-3-oxopropyl)-4-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1C(O)C(OCC)C(=O)OCC |
| InChI | InChI=1S/C24H41NO8/c1-10-13-15-14-16(20(27)32-23(4,5)6)25(22(29)33-24(7,8)9)17(15)18(26)19(30-11-2)21(28)31-12-3/h10,13,15-19,26H,11-12,14H2,1-9H3/b13-10-/t15-,16-,17-,18?,19?/m1/s1 |
| InChIKey | GPCMVVXDVAATEC-OKUILBFUSA-N |
| XLogP | 3.23 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|