C26H44N2O6 — CID 57172565
ditert-butyl (2S,4S,5R)-5-[(1R)-1-acetamido-3-ethyl-2-oxopentyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 57172565) has the molecular formula C26H44N2O6 and a molecular weight of 480.65 g/mol. Its IUPAC name is ditert-butyl (2S,4S,5R)-5-[(1R)-1-acetamido-3-ethyl-2-oxopentyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4S,5R)-5-[(1R)-1-acetamido-3-ethyl-2-oxopentyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 57172565 |
| Molecular Formula | C26H44N2O6 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.32 |
| IUPAC Name | ditert-butyl (2S,4S,5R)-5-[(1R)-1-acetamido-3-ethyl-2-oxopentyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC=C[C@@H]1C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@H]1[C@@H](NC(C)=O)C(=O)C(CC)CC |
| InChI | InChI=1S/C26H44N2O6/c1-11-14-18-15-19(23(31)33-25(5,6)7)28(24(32)34-26(8,9)10)21(18)20(27-16(4)29)22(30)17(12-2)13-3/h11,14,17-21H,12-13,15H2,1-10H3,(H,27,29)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | SNUAEWQYZXCFGT-PLACYPQZSA-N |
| XLogP | 4.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|