C23H40N2O6 — CID 90708293
ditert-butyl (2R,4S,5R)-5-acetamido-5-[(2R)-2-hydroxybutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 90708293) has the molecular formula C23H40N2O6 and a molecular weight of 440.58 g/mol. Its IUPAC name is ditert-butyl (2R,4S,5R)-5-acetamido-5-[(2R)-2-hydroxybutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2R,4S,5R)-5-acetamido-5-[(2R)-2-hydroxybutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90708293 |
| Molecular Formula | C23H40N2O6 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | ditert-butyl (2R,4S,5R)-5-acetamido-5-[(2R)-2-hydroxybutyl]-4-prop-1-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | CC=C[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)[C@@]1(C[C@H](O)CC)NC(C)=O |
| InChI | InChI=1S/C23H40N2O6/c1-10-12-16-13-18(19(28)30-21(4,5)6)25(20(29)31-22(7,8)9)23(16,24-15(3)26)14-17(27)11-2/h10,12,16-18,27H,11,13-14H2,1-9H3,(H,24,26)/t16-,17-,18-,23-/m1/s1 |
| InChIKey | BGLVROZPWSANFB-YTSMVRMISA-N |
| XLogP | 3.52 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|