C18H28N2O4 — CID 142059098
tert-butyl (1S,3R,8R,8aR)-8-acetamido-7-oxo-1-[(Z)-prop-1-enyl]-2,3,5,6,8,8a-hexahydro-1H-indolizine-3-carboxylate (PubChem CID 142059098) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is tert-butyl (1S,3R,8R,8aR)-8-acetamido-7-oxo-1-[(Z)-prop-1-enyl]-2,3,5,6,8,8a-hexahydro-1H-indolizine-3-carboxylate.
| Compound Name | tert-butyl (1S,3R,8R,8aR)-8-acetamido-7-oxo-1-[(Z)-prop-1-enyl]-2,3,5,6,8,8a-hexahydro-1H-indolizine-3-carboxylate |
|---|---|
| PubChem CID | 142059098 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | tert-butyl (1S,3R,8R,8aR)-8-acetamido-7-oxo-1-[(Z)-prop-1-enyl]-2,3,5,6,8,8a-hexahydro-1H-indolizine-3-carboxylate |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)OC(C)(C)C)N2CCC(=O)[C@H](NC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C18H28N2O4/c1-6-7-12-10-13(17(23)24-18(3,4)5)20-9-8-14(22)15(16(12)20)19-11(2)21/h6-7,12-13,15-16H,8-10H2,1-5H3,(H,19,21)/b7-6-/t12-,13-,15+,16-/m1/s1 |
| InChIKey | OFTUUJOERRVQRR-MIOIKRRZSA-N |
| XLogP | 1.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|