C17H28N2O5 — CID 46894506
tert-butyl (3S,7S,8S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxylate (PubChem CID 46894506) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl (3S,7S,8S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxylate.
| Compound Name | tert-butyl (3S,7S,8S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 46894506 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tert-butyl (3S,7S,8S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-1,2,3,6,7,8-hexahydropyrrolizine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)N2[C@H](C(=O)OC(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C17H28N2O5/c1-16(2,3)23-14(21)12-8-7-11-10(9-13(20)19(11)12)18-15(22)24-17(4,5)6/h10-12H,7-9H2,1-6H3,(H,18,22)/t10-,11-,12-/m0/s1 |
| InChIKey | KYZFATGVGRLPJN-SRVKXCTJSA-N |
| XLogP | 1.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |